C26H25N2O2PS — CID 46216990
N-methyl-N-[[(2S)-pyrrolidin-2-yl]methyl]-13-sulfanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine (PubChem CID 46216990) has the molecular formula C26H25N2O2PS and a molecular weight of 460.54 g/mol. Its IUPAC name is N-methyl-N-[[(2S)-pyrrolidin-2-yl]methyl]-13-sulfanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine.
| Compound Name | N-methyl-N-[[(2S)-pyrrolidin-2-yl]methyl]-13-sulfanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine |
|---|---|
| PubChem CID | 46216990 |
| Molecular Formula | C26H25N2O2PS |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-methyl-N-[[(2S)-pyrrolidin-2-yl]methyl]-13-sulfanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine |
| SMILES | CN(C[C@@H]1CCCN1)P1(=S)Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C26H25N2O2PS/c1-28(17-20-9-6-16-27-20)31(32)29-23-14-12-18-7-2-4-10-21(18)25(23)26-22-11-5-3-8-19(22)13-15-24(26)30-31/h2-5,7-8,10-15,20,27H,6,9,16-17H2,1H3/t20-/m0/s1 |
| InChIKey | NMMAOOKRMOQHPH-FQEVSTJZSA-N |
| XLogP | 6.34 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|