C27H24F3N2O4PS — CID 46217142
N-[[(2S)-pyrrolidin-2-yl]methyl]-13-sulfanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine;2,2,2-trifluoroacetic acid (PubChem CID 46217142) has the molecular formula C27H24F3N2O4PS and a molecular weight of 560.53 g/mol. Its IUPAC name is N-[[(2S)-pyrrolidin-2-yl]methyl]-13-sulfanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(2S)-pyrrolidin-2-yl]methyl]-13-sulfanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46217142 |
| Molecular Formula | C27H24F3N2O4PS |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | N-[[(2S)-pyrrolidin-2-yl]methyl]-13-sulfanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.S=P1(NC[C@@H]2CCCN2)Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C25H23N2O2PS.C2HF3O2/c31-30(27-16-19-8-5-15-26-19)28-22-13-11-17-6-1-3-9-20(17)24(22)25-21-10-4-2-7-18(21)12-14-23(25)29-30;3-2(4,5)1(6)7/h1-4,6-7,9-14,19,26H,5,8,15-16H2,(H,27,31);(H,6,7)/t19-;/m0./s1 |
| InChIKey | AESASNOYDJJWTG-FYZYNONXSA-N |
| XLogP | 6.63 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|