C13H17F3N2O2S — CID 143059763
N-phenylsulfanyl-1-pyrrolidin-2-ylmethanamine;2,2,2-trifluoroacetic acid (PubChem CID 143059763) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is N-phenylsulfanyl-1-pyrrolidin-2-ylmethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-phenylsulfanyl-1-pyrrolidin-2-ylmethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 143059763 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-phenylsulfanyl-1-pyrrolidin-2-ylmethanamine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc(SNCC2CCCN2)cc1 |
| InChI | InChI=1S/C11H16N2S.C2HF3O2/c1-2-6-11(7-3-1)14-13-9-10-5-4-8-12-10;3-2(4,5)1(6)7/h1-3,6-7,10,12-13H,4-5,8-9H2;(H,6,7) |
| InChIKey | JEYQPSAPRVNFMQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|