C13H14F3NO3 — CID 21080202
phenyl-[(2S)-pyrrolidin-2-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 21080202) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is phenyl-[(2S)-pyrrolidin-2-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | phenyl-[(2S)-pyrrolidin-2-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 21080202 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | phenyl-[(2S)-pyrrolidin-2-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccccc1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H13NO.C2HF3O2/c13-11(10-7-4-8-12-10)9-5-2-1-3-6-9;3-2(4,5)1(6)7/h1-3,5-6,10,12H,4,7-8H2;(H,6,7)/t10-;/m0./s1 |
| InChIKey | YWRGEGPNRKDJEF-PPHPATTJSA-N |
| XLogP | 2.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |