C22H20N2O — CID 174970018
(2,6-diphenyl-4-pyridinyl)-[(2S)-pyrrolidin-2-yl]methanone (PubChem CID 174970018) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is (2,6-diphenyl-4-pyridinyl)-[(2S)-pyrrolidin-2-yl]methanone.
| Compound Name | (2,6-diphenyl-4-pyridinyl)-[(2S)-pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 174970018 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2,6-diphenyl-4-pyridinyl)-[(2S)-pyrrolidin-2-yl]methanone |
| SMILES | O=C(c1cc(-c2ccccc2)nc(-c2ccccc2)c1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C22H20N2O/c25-22(19-12-7-13-23-19)18-14-20(16-8-3-1-4-9-16)24-21(15-18)17-10-5-2-6-11-17/h1-6,8-11,14-15,19,23H,7,12-13H2/t19-/m0/s1 |
| InChIKey | YZTOYDGQLVUXBC-IBGZPJMESA-N |
| XLogP | 4.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |