About bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid
bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid (PubChem CID 70124841) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid.
Analyze bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid?
The IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid (CID 70124841) is bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid?
The canonical SMILES for bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid is O=C(O)C1CCCN1.c1cc2ccc1-2.
What is the InChIKey of bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid?
The InChIKey is PNQDLBZTKQCWBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.C5H9NO2/c1-2-6-4-3-5(1)6;7-5(8)4-2-1-3-6-4/h1-4H;4,6H,1-3H2,(H,7,8).
What are the key properties of bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid?
bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid has a molecular weight of 191.23 g/mol, XLogP of 1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,3,5-triene;pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 70124841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).