C11H15ClN2S — CID 130322468
N-(3-chlorophenyl)sulfanyl-1-pyrrolidin-2-ylmethanamine (PubChem CID 130322468) has the molecular formula C11H15ClN2S and a molecular weight of 242.77 g/mol. Its IUPAC name is N-(3-chlorophenyl)sulfanyl-1-pyrrolidin-2-ylmethanamine.
| Compound Name | N-(3-chlorophenyl)sulfanyl-1-pyrrolidin-2-ylmethanamine |
|---|---|
| PubChem CID | 130322468 |
| Molecular Formula | C11H15ClN2S |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | N-(3-chlorophenyl)sulfanyl-1-pyrrolidin-2-ylmethanamine |
| SMILES | Clc1cccc(SNCC2CCCN2)c1 |
| InChI | InChI=1S/C11H15ClN2S/c12-9-3-1-5-11(7-9)15-14-8-10-4-2-6-13-10/h1,3,5,7,10,13-14H,2,4,6,8H2 |
| InChIKey | QDOFYQJFLDAJBR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|