C12H15ClFN — CID 105485071
2-[2-(3-chlorophenyl)-2-fluoroethyl]pyrrolidine (PubChem CID 105485071) has the molecular formula C12H15ClFN and a molecular weight of 227.71 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-2-fluoroethyl]pyrrolidine.
| Compound Name | 2-[2-(3-chlorophenyl)-2-fluoroethyl]pyrrolidine |
|---|---|
| PubChem CID | 105485071 |
| Molecular Formula | C12H15ClFN |
| Molecular Weight | 227.71 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-2-fluoroethyl]pyrrolidine |
| SMILES | FC(CC1CCCN1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H15ClFN/c13-10-4-1-3-9(7-10)12(14)8-11-5-2-6-15-11/h1,3-4,7,11-12,15H,2,5-6,8H2 |
| InChIKey | BSLDZFPGOGRBQJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |