C40H36NO2PSe — CID 101400723
N-benzyl-N-[(S)-cyclohexyl(phenyl)methyl]-13-selanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine (PubChem CID 101400723) has the molecular formula C40H36NO2PSe and a molecular weight of 672.67 g/mol. Its IUPAC name is N-benzyl-N-[(S)-cyclohexyl(phenyl)methyl]-13-selanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine.
| Compound Name | N-benzyl-N-[(S)-cyclohexyl(phenyl)methyl]-13-selanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine |
|---|---|
| PubChem CID | 101400723 |
| Molecular Formula | C40H36NO2PSe |
| Molecular Weight | 672.67 g/mol |
| Exact Mass | 673.16 |
| IUPAC Name | N-benzyl-N-[(S)-cyclohexyl(phenyl)methyl]-13-selanylidene-12,14-dioxa-13λ5-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine |
| SMILES | [Se]=P1(N(Cc2ccccc2)[C@H](c2ccccc2)C2CCCCC2)Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C40H36NO2PSe/c45-44(41(28-29-14-4-1-5-15-29)40(32-18-6-2-7-19-32)33-20-8-3-9-21-33)42-36-26-24-30-16-10-12-22-34(30)38(36)39-35-23-13-11-17-31(35)25-27-37(39)43-44/h1-2,4-7,10-19,22-27,33,40H,3,8-9,20-21,28H2/t40-/m1/s1 |
| InChIKey | NNCQPKHMPHKWSS-RRHRGVEJSA-N |
| XLogP | 11.10 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.67 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|