C56H60N4O6P4 — CID 139179483
25,26-ditert-butyl-2,23-dioxa-25,26-diaza-1λ5,24-diphosphahexacyclo[22.1.1.03,12.06,11.013,22.014,19]hexacosa-3(12),4,6,8,10,13(22),14,16,18,20-decaene 1-oxide (PubChem CID 139179483) has the molecular formula C56H60N4O6P4 and a molecular weight of 1009.01 g/mol. Its IUPAC name is 25,26-ditert-butyl-2,23-dioxa-25,26-diaza-1λ5,24-diphosphahexacyclo[22.1.1.03,12.06,11.013,22.014,19]hexacosa-3(12),4,6,8,10,13(22),14,16,18,20-decaene 1-oxide.
| Compound Name | 25,26-ditert-butyl-2,23-dioxa-25,26-diaza-1λ5,24-diphosphahexacyclo[22.1.1.03,12.06,11.013,22.014,19]hexacosa-3(12),4,6,8,10,13(22),14,16,18,20-decaene 1-oxide |
|---|---|
| PubChem CID | 139179483 |
| Molecular Formula | C56H60N4O6P4 |
| Molecular Weight | 1009.01 g/mol |
| Exact Mass | 1008.35 |
| IUPAC Name | 25,26-ditert-butyl-2,23-dioxa-25,26-diaza-1λ5,24-diphosphahexacyclo[22.1.1.03,12.06,11.013,22.014,19]hexacosa-3(12),4,6,8,10,13(22),14,16,18,20-decaene 1-oxide |
| SMILES | CC(C)(C)N1P2Oc3ccc4ccccc4c3-c3c(ccc4ccccc34)OP1(=O)N2C(C)(C)C.CC(C)(C)N1P2Oc3ccc4ccccc4c3-c3c(ccc4ccccc34)OP1(=O)N2C(C)(C)C |
| InChI | InChI=1S/2C28H30N2O3P2/c2*1-27(2,3)29-34-30(28(4,5)6)35(29,31)33-24-18-16-20-12-8-10-14-22(20)26(24)25-21-13-9-7-11-19(21)15-17-23(25)32-34/h2*7-18H,1-6H3 |
| InChIKey | MADMACIMCROZMD-UHFFFAOYSA-N |
| XLogP | 17.96 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.01 |
| LogP ≤ 5 | 17.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|