C34H30Si2 — CID 59133595
4-[2-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)phenyl]-5,5-dimethylbenzo[b][1]benzosilole (PubChem CID 59133595) has the molecular formula C34H30Si2 and a molecular weight of 494.79 g/mol. Its IUPAC name is 4-[2-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)phenyl]-5,5-dimethylbenzo[b][1]benzosilole.
| Compound Name | 4-[2-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)phenyl]-5,5-dimethylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 59133595 |
| Molecular Formula | C34H30Si2 |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 4-[2-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)phenyl]-5,5-dimethylbenzo[b][1]benzosilole |
| SMILES | C[Si]1(C)c2ccccc2-c2cccc(-c3ccccc3-c3cccc4c3[Si](C)(C)c3ccccc3-4)c21 |
| InChI | InChI=1S/C34H30Si2/c1-35(2)31-21-9-7-15-25(31)29-19-11-17-27(33(29)35)23-13-5-6-14-24(23)28-18-12-20-30-26-16-8-10-22-32(26)36(3,4)34(28)30/h5-22H,1-4H3 |
| InChIKey | VFBRVGGSWUNDOE-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|