C30H28Si — CID 617108
dimethyl-bis(2-methyl-3H-cyclopenta[a]naphthalen-3-yl)silane (PubChem CID 617108) has the molecular formula C30H28Si and a molecular weight of 416.64 g/mol. Its IUPAC name is dimethyl-bis(2-methyl-3H-cyclopenta[a]naphthalen-3-yl)silane.
| Compound Name | dimethyl-bis(2-methyl-3H-cyclopenta[a]naphthalen-3-yl)silane |
|---|---|
| PubChem CID | 617108 |
| Molecular Formula | C30H28Si |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | dimethyl-bis(2-methyl-3H-cyclopenta[a]naphthalen-3-yl)silane |
| SMILES | CC1=Cc2c(ccc3ccccc23)C1[Si](C)(C)C1C(C)=Cc2c1ccc1ccccc21 |
| InChI | InChI=1S/C30H28Si/c1-19-17-27-23-11-7-5-9-21(23)13-15-25(27)29(19)31(3,4)30-20(2)18-28-24-12-8-6-10-22(24)14-16-26(28)30/h5-18,29-30H,1-4H3 |
| InChIKey | BFYCOQTXODFUOQ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|