C20H27NSi — CID 135046771
N-[dimethyl-(2-methyl-3H-cyclopenta[a]naphthalen-3-yl)silyl]-2-methylpropan-2-amine (PubChem CID 135046771) has the molecular formula C20H27NSi and a molecular weight of 309.53 g/mol. Its IUPAC name is N-[dimethyl-(2-methyl-3H-cyclopenta[a]naphthalen-3-yl)silyl]-2-methylpropan-2-amine.
| Compound Name | N-[dimethyl-(2-methyl-3H-cyclopenta[a]naphthalen-3-yl)silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 135046771 |
| Molecular Formula | C20H27NSi |
| Molecular Weight | 309.53 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-[dimethyl-(2-methyl-3H-cyclopenta[a]naphthalen-3-yl)silyl]-2-methylpropan-2-amine |
| SMILES | CC1=Cc2c(ccc3ccccc23)C1[Si](C)(C)NC(C)(C)C |
| InChI | InChI=1S/C20H27NSi/c1-14-13-18-16-10-8-7-9-15(16)11-12-17(18)19(14)22(5,6)21-20(2,3)4/h7-13,19,21H,1-6H3 |
| InChIKey | ZCFSZUIHMDQJCL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|