C18H21Si — CID 142750810
CID 142750810 (PubChem CID 142750810) has the molecular formula C18H21Si and a molecular weight of 265.45 g/mol.
| Compound Name | CID 142750810 |
|---|---|
| PubChem CID | 142750810 |
| Molecular Formula | C18H21Si |
| Molecular Weight | 265.45 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)C1C(C)=Cc2c1ccc1ccccc21 |
| InChI | InChI=1S/C18H21Si/c1-4-19(5-2)18-13(3)12-17-15-9-7-6-8-14(15)10-11-16(17)18/h6-12,18H,4-5H2,1-3H3 |
| InChIKey | VTLWBXYUKKBBMJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|