About CID 142753465
CID 142753465 (PubChem CID 142753465) has the molecular formula C44H52Si2
and a molecular weight of 637.07 g/mol.
Molecular Properties
| Compound Name | CID 142753465 |
| PubChem CID | 142753465 |
| Molecular Formula | C44H52Si2 |
| Molecular Weight | 637.07 g/mol |
| Exact Mass | 636.36 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)[Si](C1C(C)=Cc2c(-c3ccc(C(C)(C)C)cc3)cccc21)C1C(C)=Cc2c(-c3ccc(C(C)(C)C)cc3)cccc21 |
| InChI | InChI=1S/C44H52Si2/c1-11-45(12-2)46(41-29(3)27-39-35(15-13-17-37(39)41)31-19-23-33(24-20-31)43(5,6)7)42-30(4)28-40-36(16-14-18-38(40)42)32-21-25-34(26-22-32)44(8,9)10/h13-28,41-42H,11-12H2,1-10H3 |
| InChIKey | KORWGADMWFSOKW-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 637.07 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 142753465 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142753465?
The IUPAC name of CID 142753465 (CID 142753465) is not available.
What is the SMILES notation for CID 142753465?
The canonical SMILES for CID 142753465 is CC[Si](CC)[Si](C1C(C)=Cc2c(-c3ccc(C(C)(C)C)cc3)cccc21)C1C(C)=Cc2c(-c3ccc(C(C)(C)C)cc3)cccc21.
What is the InChIKey of CID 142753465?
The InChIKey is KORWGADMWFSOKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H52Si2/c1-11-45(12-2)46(41-29(3)27-39-35(15-13-17-37(39)41)31-19-23-33(24-20-31)43(5,6)7)42-30(4)28-40-36(16-14-18-38(40)42)32-21-25-34(26-22-32)44(8,9)10/h13-28,41-42H,11-12H2,1-10H3.
What are the key properties of CID 142753465?
CID 142753465 has a molecular weight of 637.07 g/mol, XLogP of 12.50, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142753465 is sourced from PubChem (CID 142753465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).