C45H53Si — CID 91311200
CID 91311200 (PubChem CID 91311200) has the molecular formula C45H53Si and a molecular weight of 622.01 g/mol.
| Compound Name | CID 91311200 |
|---|---|
| PubChem CID | 91311200 |
| Molecular Formula | C45H53Si |
| Molecular Weight | 622.01 g/mol |
| Exact Mass | 621.39 |
| IUPAC Name | — |
| SMILES | CCCCC[Si](C1C(C)=Cc2c(-c3ccc(C(C)(C)C)cc3)cccc21)C1C(C)=Cc2c(-c3ccc(C(C)(C)C)cc3)cccc21 |
| InChI | InChI=1S/C45H53Si/c1-10-11-12-27-46(42-30(2)28-40-36(15-13-17-38(40)42)32-19-23-34(24-20-32)44(4,5)6)43-31(3)29-41-37(16-14-18-39(41)43)33-21-25-35(26-22-33)45(7,8)9/h13-26,28-29,42-43H,10-12,27H2,1-9H3 |
| InChIKey | IOQUZNSMVXBPAX-UHFFFAOYSA-N |
| XLogP | 13.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.01 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|