About CID 173305494
CID 173305494 (PubChem CID 173305494) has the molecular formula C24H29SiTi
and a molecular weight of 393.45 g/mol.
Molecular Properties
| Compound Name | CID 173305494 |
| PubChem CID | 173305494 |
| Molecular Formula | C24H29SiTi |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | — |
| SMILES | CC1=Cc2c(-c3ccccc3)cccc2C1[Si](C)C.CC=CC=CC.[Ti] |
| InChI | InChI=1S/C18H19Si.C6H10.Ti/c1-13-12-17-15(14-8-5-4-6-9-14)10-7-11-16(17)18(13)19(2)3;1-3-5-6-4-2;/h4-12,18H,1-3H3;3-6H,1-2H3; |
| InChIKey | AFDFCBSGCYTOBN-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 173305494 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173305494?
The IUPAC name of CID 173305494 (CID 173305494) is not available.
What is the SMILES notation for CID 173305494?
The canonical SMILES for CID 173305494 is CC1=Cc2c(-c3ccccc3)cccc2C1[Si](C)C.CC=CC=CC.[Ti].
What is the InChIKey of CID 173305494?
The InChIKey is AFDFCBSGCYTOBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19Si.C6H10.Ti/c1-13-12-17-15(14-8-5-4-6-9-14)10-7-11-16(17)18(13)19(2)3;1-3-5-6-4-2;/h4-12,18H,1-3H3;3-6H,1-2H3;.
What are the key properties of CID 173305494?
CID 173305494 has a molecular weight of 393.45 g/mol, XLogP of 7.28, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173305494 is sourced from PubChem (CID 173305494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).