C49H53Si — CID 162724348
CID 162724348 (PubChem CID 162724348) has the molecular formula C49H53Si and a molecular weight of 670.05 g/mol.
| Compound Name | CID 162724348 |
|---|---|
| PubChem CID | 162724348 |
| Molecular Formula | C49H53Si |
| Molecular Weight | 670.05 g/mol |
| Exact Mass | 669.39 |
| IUPAC Name | — |
| SMILES | CC1=Cc2c(-c3ccc(C(C)(C)C)cc3)cccc2C1[Si](CC1C(C(C)C)=Cc2c(-c3ccc(C(C)(C)C)cc3)cccc21)c1ccccc1 |
| InChI | InChI=1S/C49H53Si/c1-32(2)43-30-45-40(35-23-27-37(28-24-35)49(7,8)9)17-13-19-41(45)46(43)31-50(38-15-11-10-12-16-38)47-33(3)29-44-39(18-14-20-42(44)47)34-21-25-36(26-22-34)48(4,5)6/h10-30,32,46-47H,31H2,1-9H3 |
| InChIKey | NXTPOPXTMKVPDN-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.05 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|