C33H52NOSi — CID 175414627
CID 175414627 (PubChem CID 175414627) has the molecular formula C33H52NOSi and a molecular weight of 506.87 g/mol.
| Compound Name | CID 175414627 |
|---|---|
| PubChem CID | 175414627 |
| Molecular Formula | C33H52NOSi |
| Molecular Weight | 506.87 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | — |
| SMILES | CC(C)(C)N.CC(C)C1=Cc2c(-c3ccccc3)cccc2C1[Si](C)CCCCCCOC(C)(C)C |
| InChI | InChI=1S/C29H41OSi.C4H11N/c1-22(2)26-21-27-24(23-15-10-9-11-16-23)17-14-18-25(27)28(26)31(6)20-13-8-7-12-19-30-29(3,4)5;1-4(2,3)5/h9-11,14-18,21-22,28H,7-8,12-13,19-20H2,1-6H3;5H2,1-3H3 |
| InChIKey | WEELCNZUFGQLMM-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.87 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|