C25H43NOSi — CID 169279364
2-methyl-N-[methyl-(2-methyl-1H-inden-1-yl)-[6-[(2-methylpropan-2-yl)oxy]hexyl]silyl]propan-2-amine (PubChem CID 169279364) has the molecular formula C25H43NOSi and a molecular weight of 401.71 g/mol. Its IUPAC name is 2-methyl-N-[methyl-(2-methyl-1H-inden-1-yl)-[6-[(2-methylpropan-2-yl)oxy]hexyl]silyl]propan-2-amine.
| Compound Name | 2-methyl-N-[methyl-(2-methyl-1H-inden-1-yl)-[6-[(2-methylpropan-2-yl)oxy]hexyl]silyl]propan-2-amine |
|---|---|
| PubChem CID | 169279364 |
| Molecular Formula | C25H43NOSi |
| Molecular Weight | 401.71 g/mol |
| Exact Mass | 401.31 |
| IUPAC Name | 2-methyl-N-[methyl-(2-methyl-1H-inden-1-yl)-[6-[(2-methylpropan-2-yl)oxy]hexyl]silyl]propan-2-amine |
| SMILES | CC1=Cc2ccccc2C1[Si](C)(CCCCCCOC(C)(C)C)NC(C)(C)C |
| InChI | InChI=1S/C25H43NOSi/c1-20-19-21-15-11-12-16-22(21)23(20)28(8,26-24(2,3)4)18-14-10-9-13-17-27-25(5,6)7/h11-12,15-16,19,23,26H,9-10,13-14,17-18H2,1-8H3 |
| InChIKey | GPFCLVSXZBXAPT-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.71 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|