C43H49NOSi — CID 168786477
1H-inden-1-yl-methyl-[2-methyl-4-(9-methylcarbazol-3-yl)-1H-inden-1-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane (PubChem CID 168786477) has the molecular formula C43H49NOSi and a molecular weight of 623.96 g/mol. Its IUPAC name is 1H-inden-1-yl-methyl-[2-methyl-4-(9-methylcarbazol-3-yl)-1H-inden-1-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane.
| Compound Name | 1H-inden-1-yl-methyl-[2-methyl-4-(9-methylcarbazol-3-yl)-1H-inden-1-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
|---|---|
| PubChem CID | 168786477 |
| Molecular Formula | C43H49NOSi |
| Molecular Weight | 623.96 g/mol |
| Exact Mass | 623.36 |
| IUPAC Name | 1H-inden-1-yl-methyl-[2-methyl-4-(9-methylcarbazol-3-yl)-1H-inden-1-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
| SMILES | CC1=Cc2c(-c3ccc4c(c3)c3ccccc3n4C)cccc2C1[Si](C)(CCCCCCOC(C)(C)C)C1C=Cc2ccccc21 |
| InChI | InChI=1S/C43H49NOSi/c1-30-28-37-33(32-22-24-40-38(29-32)35-18-11-12-21-39(35)44(40)5)19-15-20-36(37)42(30)46(6,27-14-8-7-13-26-45-43(2,3)4)41-25-23-31-16-9-10-17-34(31)41/h9-12,15-25,28-29,41-42H,7-8,13-14,26-27H2,1-6H3 |
| InChIKey | DZIXQBNLZLQSQI-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.96 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|