C38H43Cl2NOZr — CID 168786462
dichlorozirconium(2+);9-methyl-3-(2-methyl-1H-inden-1-id-4-yl)carbazole;2-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene (PubChem CID 168786462) has the molecular formula C38H43Cl2NOZr and a molecular weight of 691.90 g/mol. Its IUPAC name is dichlorozirconium(2+);9-methyl-3-(2-methyl-1H-inden-1-id-4-yl)carbazole;2-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene.
| Compound Name | dichlorozirconium(2+);9-methyl-3-(2-methyl-1H-inden-1-id-4-yl)carbazole;2-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 168786462 |
| Molecular Formula | C38H43Cl2NOZr |
| Molecular Weight | 691.90 g/mol |
| Exact Mass | 689.18 |
| IUPAC Name | dichlorozirconium(2+);9-methyl-3-(2-methyl-1H-inden-1-id-4-yl)carbazole;2-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene |
| SMILES | CC(C)(C)OCCCCCCc1cc[cH-]c1.Cc1cc2c(-c3ccc4c(c3)c3ccccc3n4C)cccc2[cH-]1.Cl[Zr+2]Cl |
| InChI | InChI=1S/C23H18N.C15H25O.2ClH.Zr/c1-15-12-16-6-5-8-18(20(16)13-15)17-10-11-23-21(14-17)19-7-3-4-9-22(19)24(23)2;1-15(2,3)16-13-9-5-4-6-10-14-11-7-8-12-14;;;/h3-14H,1-2H3;7-8,11-12H,4-6,9-10,13H2,1-3H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | KPIJJYUENWUKOV-UHFFFAOYSA-L |
| XLogP | 11.88 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.90 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|