C32H31Cl2NZr — CID 168786497
2-butylcyclopenta-1,3-diene;dichlorozirconium(2+);9-methyl-3-(2-methyl-1H-inden-1-id-4-yl)carbazole (PubChem CID 168786497) has the molecular formula C32H31Cl2NZr and a molecular weight of 591.74 g/mol. Its IUPAC name is 2-butylcyclopenta-1,3-diene;dichlorozirconium(2+);9-methyl-3-(2-methyl-1H-inden-1-id-4-yl)carbazole.
| Compound Name | 2-butylcyclopenta-1,3-diene;dichlorozirconium(2+);9-methyl-3-(2-methyl-1H-inden-1-id-4-yl)carbazole |
|---|---|
| PubChem CID | 168786497 |
| Molecular Formula | C32H31Cl2NZr |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 589.09 |
| IUPAC Name | 2-butylcyclopenta-1,3-diene;dichlorozirconium(2+);9-methyl-3-(2-methyl-1H-inden-1-id-4-yl)carbazole |
| SMILES | CCCCc1cc[cH-]c1.Cc1cc2c(-c3ccc4c(c3)c3ccccc3n4C)cccc2[cH-]1.Cl[Zr+2]Cl |
| InChI | InChI=1S/C23H18N.C9H13.2ClH.Zr/c1-15-12-16-6-5-8-18(20(16)13-15)17-10-11-23-21(14-17)19-7-3-4-9-22(19)24(23)2;1-2-3-6-9-7-4-5-8-9;;;/h3-14H,1-2H3;4-5,7-8H,2-3,6H2,1H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | IBCFJBNVOYNHME-UHFFFAOYSA-L |
| XLogP | 10.30 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|