C54H52Cl2N2SiZr — CID 168786639
dichlorozirconium(2+);[3-hexyl-2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]-dimethyl-[2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]silane (PubChem CID 168786639) has the molecular formula C54H52Cl2N2SiZr and a molecular weight of 919.24 g/mol. Its IUPAC name is dichlorozirconium(2+);[3-hexyl-2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]-dimethyl-[2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]silane.
| Compound Name | dichlorozirconium(2+);[3-hexyl-2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]-dimethyl-[2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]silane |
|---|---|
| PubChem CID | 168786639 |
| Molecular Formula | C54H52Cl2N2SiZr |
| Molecular Weight | 919.24 g/mol |
| Exact Mass | 916.23 |
| IUPAC Name | dichlorozirconium(2+);[3-hexyl-2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]-dimethyl-[2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]silane |
| SMILES | CCCCCCc1c(C)[c-]([Si](C)(C)[c-]2c(C)cc3c(-c4ccc5c(c4)c4ccccc4n5C)cccc32)c2cccc(-c3ccc4c(c3)c3ccccc3n4C)c12.Cl[Zr+2]Cl |
| InChI | InChI=1S/C54H52N2Si.2ClH.Zr/c1-8-9-10-11-18-38-35(3)54(44-24-17-22-40(52(38)44)37-28-30-51-47(33-37)42-20-13-15-26-49(42)56(51)5)57(6,7)53-34(2)31-45-39(21-16-23-43(45)53)36-27-29-50-46(32-36)41-19-12-14-25-48(41)55(50)4;;;/h12-17,19-33H,8-11,18H2,1-7H3;2*1H;/q-2;;;+4/p-2 |
| InChIKey | WXGKKKMEQVRTGM-UHFFFAOYSA-L |
| XLogP | 14.99 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.24 |
| LogP ≤ 5 | 14.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|