C20H26N2 — CID 11426410
5-methyl-3-octylpyrido[4,3-b]indole (PubChem CID 11426410) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 5-methyl-3-octylpyrido[4,3-b]indole.
| Compound Name | 5-methyl-3-octylpyrido[4,3-b]indole |
|---|---|
| PubChem CID | 11426410 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 5-methyl-3-octylpyrido[4,3-b]indole |
| SMILES | CCCCCCCCc1cc2c(cn1)c1ccccc1n2C |
| InChI | InChI=1S/C20H26N2/c1-3-4-5-6-7-8-11-16-14-20-18(15-21-16)17-12-9-10-13-19(17)22(20)2/h9-10,12-15H,3-8,11H2,1-2H3 |
| InChIKey | VVWVFBGSRRSEAQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|