About 5-methyl-3-octylpyrido[4,3-b]indole
5-methyl-3-octylpyrido[4,3-b]indole (PubChem CID 11426410) has the molecular formula C20H26N2
and a molecular weight of 294.44 g/mol. Its IUPAC name is 5-methyl-3-octylpyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 5-methyl-3-octylpyrido[4,3-b]indole |
| PubChem CID | 11426410 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 5-methyl-3-octylpyrido[4,3-b]indole |
| SMILES | CCCCCCCCc1cc2c(cn1)c1ccccc1n2C |
| InChI | InChI=1S/C20H26N2/c1-3-4-5-6-7-8-11-16-14-20-18(15-21-16)17-12-9-10-13-19(17)22(20)2/h9-10,12-15H,3-8,11H2,1-2H3 |
| InChIKey | VVWVFBGSRRSEAQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-octylpyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-octylpyrido[4,3-b]indole?
The IUPAC name of 5-methyl-3-octylpyrido[4,3-b]indole (CID 11426410) is 5-methyl-3-octylpyrido[4,3-b]indole.
What is the SMILES notation for 5-methyl-3-octylpyrido[4,3-b]indole?
The canonical SMILES for 5-methyl-3-octylpyrido[4,3-b]indole is CCCCCCCCc1cc2c(cn1)c1ccccc1n2C.
What is the InChIKey of 5-methyl-3-octylpyrido[4,3-b]indole?
The InChIKey is VVWVFBGSRRSEAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2/c1-3-4-5-6-7-8-11-16-14-20-18(15-21-16)17-12-9-10-13-19(17)22(20)2/h9-10,12-15H,3-8,11H2,1-2H3.
What are the key properties of 5-methyl-3-octylpyrido[4,3-b]indole?
5-methyl-3-octylpyrido[4,3-b]indole has a molecular weight of 294.44 g/mol, XLogP of 5.63, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-octylpyrido[4,3-b]indole is sourced from PubChem (CID 11426410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).