About benzene;3-pentylisoquinoline
benzene;3-pentylisoquinoline (PubChem CID 175224692) has the molecular formula C20H23N
and a molecular weight of 277.41 g/mol. Its IUPAC name is benzene;3-pentylisoquinoline.
Molecular Properties
| Compound Name | benzene;3-pentylisoquinoline |
| PubChem CID | 175224692 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | benzene;3-pentylisoquinoline |
| SMILES | CCCCCc1cc2ccccc2cn1.c1ccccc1 |
| InChI | InChI=1S/C14H17N.C6H6/c1-2-3-4-9-14-10-12-7-5-6-8-13(12)11-15-14;1-2-4-6-5-3-1/h5-8,10-11H,2-4,9H2,1H3;1-6H |
| InChIKey | GAZWVRJGTJPTNL-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzene;3-pentylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;3-pentylisoquinoline?
The IUPAC name of benzene;3-pentylisoquinoline (CID 175224692) is benzene;3-pentylisoquinoline.
What is the SMILES notation for benzene;3-pentylisoquinoline?
The canonical SMILES for benzene;3-pentylisoquinoline is CCCCCc1cc2ccccc2cn1.c1ccccc1.
What is the InChIKey of benzene;3-pentylisoquinoline?
The InChIKey is GAZWVRJGTJPTNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N.C6H6/c1-2-3-4-9-14-10-12-7-5-6-8-13(12)11-15-14;1-2-4-6-5-3-1/h5-8,10-11H,2-4,9H2,1H3;1-6H.
What are the key properties of benzene;3-pentylisoquinoline?
benzene;3-pentylisoquinoline has a molecular weight of 277.41 g/mol, XLogP of 5.65, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;3-pentylisoquinoline is sourced from PubChem (CID 175224692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).