About 3-pentylphenanthridine
3-pentylphenanthridine (PubChem CID 159687285) has the molecular formula C18H19N
and a molecular weight of 249.36 g/mol. Its IUPAC name is 3-pentylphenanthridine.
Molecular Properties
| Compound Name | 3-pentylphenanthridine |
| PubChem CID | 159687285 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 3-pentylphenanthridine |
| SMILES | CCCCCc1ccc2c(c1)ncc1ccccc12 |
| InChI | InChI=1S/C18H19N/c1-2-3-4-7-14-10-11-17-16-9-6-5-8-15(16)13-19-18(17)12-14/h5-6,8-13H,2-4,7H2,1H3 |
| InChIKey | MVYOGNCKVJVVQR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-pentylphenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentylphenanthridine?
The IUPAC name of 3-pentylphenanthridine (CID 159687285) is 3-pentylphenanthridine.
What is the SMILES notation for 3-pentylphenanthridine?
The canonical SMILES for 3-pentylphenanthridine is CCCCCc1ccc2c(c1)ncc1ccccc12.
What is the InChIKey of 3-pentylphenanthridine?
The InChIKey is MVYOGNCKVJVVQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N/c1-2-3-4-7-14-10-11-17-16-9-6-5-8-15(16)13-19-18(17)12-14/h5-6,8-13H,2-4,7H2,1H3.
What are the key properties of 3-pentylphenanthridine?
3-pentylphenanthridine has a molecular weight of 249.36 g/mol, XLogP of 5.12, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentylphenanthridine is sourced from PubChem (CID 159687285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).