C42H51Cl2NOSiZr — CID 168786523
dichlorozirconium(2+);diethyl-[2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-2,4-dien-1-yl]silane (PubChem CID 168786523) has the molecular formula C42H51Cl2NOSiZr and a molecular weight of 776.09 g/mol. Its IUPAC name is dichlorozirconium(2+);diethyl-[2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-2,4-dien-1-yl]silane.
| Compound Name | dichlorozirconium(2+);diethyl-[2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 168786523 |
| Molecular Formula | C42H51Cl2NOSiZr |
| Molecular Weight | 776.09 g/mol |
| Exact Mass | 773.22 |
| IUPAC Name | dichlorozirconium(2+);diethyl-[2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]-[3-[6-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-2,4-dien-1-yl]silane |
| SMILES | CC[Si](CC)([c-]1ccc(CCCCCCOC(C)(C)C)c1)[c-]1c(C)cc2c(-c3ccc4c(c3)c3ccccc3n4C)cccc21.Cl[Zr+2]Cl |
| InChI | InChI=1S/C42H51NOSi.2ClH.Zr/c1-8-45(9-2,33-24-22-31(28-33)17-12-10-11-15-26-44-42(4,5)6)41-30(3)27-37-34(19-16-20-36(37)41)32-23-25-40-38(29-32)35-18-13-14-21-39(35)43(40)7;;;/h13-14,16,18-25,27-29H,8-12,15,17,26H2,1-7H3;2*1H;/q-2;;;+4/p-2 |
| InChIKey | INHCZSKVOCDGKU-UHFFFAOYSA-L |
| XLogP | 11.80 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.09 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|