C47H49Cl2NOSiZr — CID 168786516
dichlorozirconium(2+);fluoren-9-id-9-yl-methyl-[2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane (PubChem CID 168786516) has the molecular formula C47H49Cl2NOSiZr and a molecular weight of 834.13 g/mol. Its IUPAC name is dichlorozirconium(2+);fluoren-9-id-9-yl-methyl-[2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane.
| Compound Name | dichlorozirconium(2+);fluoren-9-id-9-yl-methyl-[2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
|---|---|
| PubChem CID | 168786516 |
| Molecular Formula | C47H49Cl2NOSiZr |
| Molecular Weight | 834.13 g/mol |
| Exact Mass | 831.20 |
| IUPAC Name | dichlorozirconium(2+);fluoren-9-id-9-yl-methyl-[2-methyl-4-(9-methylcarbazol-3-yl)inden-1-id-1-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
| SMILES | Cc1cc2c(-c3ccc4c(c3)c3ccccc3n4C)cccc2[c-]1[Si](C)(CCCCCCOC(C)(C)C)[c-]1c2ccccc2c2ccccc21.Cl[Zr+2]Cl |
| InChI | InChI=1S/C47H49NOSi.2ClH.Zr/c1-32-30-41-34(33-26-27-44-42(31-33)37-20-13-14-25-43(37)48(44)5)23-17-24-40(41)45(32)50(6,29-16-8-7-15-28-49-47(2,3)4)46-38-21-11-9-18-35(38)36-19-10-12-22-39(36)46;;;/h9-14,17-27,30-31H,7-8,15-16,28-29H2,1-6H3;2*1H;/q-2;;;+4/p-2 |
| InChIKey | ZSFMTYVRMMMDKH-UHFFFAOYSA-L |
| XLogP | 13.15 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.13 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|