About dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide)
dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide) (PubChem CID 174443615) has the molecular formula C44H50Cl2Zr
and a molecular weight of 741.01 g/mol. Its IUPAC name is dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide).
Molecular Properties
| Compound Name | dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide) |
| PubChem CID | 174443615 |
| Molecular Formula | C44H50Cl2Zr |
| Molecular Weight | 741.01 g/mol |
| Exact Mass | 738.23 |
| IUPAC Name | dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide) |
| SMILES | CCCCCCc1cc2c(-c3ccc(C)cc3)cccc2[cH-]1.CCCCCCc1cc2c(-c3ccc(C)cc3)cccc2[cH-]1.Cl[Zr+2]Cl |
| InChI | InChI=1S/2C22H25.2ClH.Zr/c2*1-3-4-5-6-8-18-15-20-9-7-10-21(22(20)16-18)19-13-11-17(2)12-14-19;;;/h2*7,9-16H,3-6,8H2,1-2H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | BRSPBUFLPXXYEJ-UHFFFAOYSA-L |
| XLogP | 14.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 741.01 |
| LogP ≤ 5 | 14.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide)?
The IUPAC name of dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide) (CID 174443615) is dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide).
What is the SMILES notation for dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide)?
The canonical SMILES for dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide) is CCCCCCc1cc2c(-c3ccc(C)cc3)cccc2[cH-]1.CCCCCCc1cc2c(-c3ccc(C)cc3)cccc2[cH-]1.Cl[Zr+2]Cl.
What is the InChIKey of dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide)?
The InChIKey is BRSPBUFLPXXYEJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C22H25.2ClH.Zr/c2*1-3-4-5-6-8-18-15-20-9-7-10-21(22(20)16-18)19-13-11-17(2)12-14-19;;;/h2*7,9-16H,3-6,8H2,1-2H3;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide)?
dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide) has a molecular weight of 741.01 g/mol, XLogP of 14.69, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium(2+);bis(2-hexyl-4-(4-methylphenyl)-1H-inden-1-ide) is sourced from PubChem (CID 174443615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).