C31H37Cl2Zr- — CID 174426664
dichlorozirconium;1-[4-(2-hexyl-1H-inden-1-id-4-yl)phenyl]adamantane (PubChem CID 174426664) has the molecular formula C31H37Cl2Zr- and a molecular weight of 571.77 g/mol. Its IUPAC name is dichlorozirconium;1-[4-(2-hexyl-1H-inden-1-id-4-yl)phenyl]adamantane.
| Compound Name | dichlorozirconium;1-[4-(2-hexyl-1H-inden-1-id-4-yl)phenyl]adamantane |
|---|---|
| PubChem CID | 174426664 |
| Molecular Formula | C31H37Cl2Zr- |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | dichlorozirconium;1-[4-(2-hexyl-1H-inden-1-id-4-yl)phenyl]adamantane |
| SMILES | CCCCCCc1cc2c(-c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)cccc2[cH-]1.Cl[Zr]Cl |
| InChI | InChI=1S/C31H37.2ClH.Zr/c1-2-3-4-5-7-22-17-27-8-6-9-29(30(27)18-22)26-10-12-28(13-11-26)31-19-23-14-24(20-31)16-25(15-23)21-31;;;/h6,8-13,17-18,23-25H,2-5,7,14-16,19-21H2,1H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | XACRLPLQAPALAS-UHFFFAOYSA-L |
| XLogP | 10.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|