C31H45OSi — CID 174294695
CID 174294695 (PubChem CID 174294695) has the molecular formula C31H45OSi and a molecular weight of 461.79 g/mol.
| Compound Name | CID 174294695 |
|---|---|
| PubChem CID | 174294695 |
| Molecular Formula | C31H45OSi |
| Molecular Weight | 461.79 g/mol |
| Exact Mass | 461.32 |
| IUPAC Name | — |
| SMILES | CC1=Cc2c(-c3ccc(C(C)(C)C)cc3)cccc2C1[Si](C)CCCCCCOC(C)(C)C |
| InChI | InChI=1S/C31H45OSi/c1-23-22-28-26(24-16-18-25(19-17-24)30(2,3)4)14-13-15-27(28)29(23)33(8)21-12-10-9-11-20-32-31(5,6)7/h13-19,22,29H,9-12,20-21H2,1-8H3 |
| InChIKey | XOZXMHALGLMAFD-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.79 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|