C50H64Si — CID 162291107
dibutyl-[4-(4-tert-butylphenyl)-2-methyl-1H-inden-1-yl]-[4-(4-tert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]silane (PubChem CID 162291107) has the molecular formula C50H64Si and a molecular weight of 693.15 g/mol. Its IUPAC name is dibutyl-[4-(4-tert-butylphenyl)-2-methyl-1H-inden-1-yl]-[4-(4-tert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]silane.
| Compound Name | dibutyl-[4-(4-tert-butylphenyl)-2-methyl-1H-inden-1-yl]-[4-(4-tert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]silane |
|---|---|
| PubChem CID | 162291107 |
| Molecular Formula | C50H64Si |
| Molecular Weight | 693.15 g/mol |
| Exact Mass | 692.48 |
| IUPAC Name | dibutyl-[4-(4-tert-butylphenyl)-2-methyl-1H-inden-1-yl]-[4-(4-tert-butylphenyl)-2-propan-2-yl-1H-inden-1-yl]silane |
| SMILES | CCCC[Si](CCCC)(C1C(C)=Cc2c(-c3ccc(C(C)(C)C)cc3)cccc21)C1C(C(C)C)=Cc2c(-c3ccc(C(C)(C)C)cc3)cccc21 |
| InChI | InChI=1S/C50H64Si/c1-12-14-30-51(31-15-13-2,47-35(5)32-45-40(18-16-20-42(45)47)36-22-26-38(27-23-36)49(6,7)8)48-43-21-17-19-41(46(43)33-44(48)34(3)4)37-24-28-39(29-25-37)50(9,10)11/h16-29,32-34,47-48H,12-15,30-31H2,1-11H3 |
| InChIKey | FNNZGXJUMNEDHP-UHFFFAOYSA-N |
| XLogP | 15.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.15 |
| LogP ≤ 5 | 15.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|