C34H32Si — CID 101111754
dimethyl-bis[(1R)-2-methyl-4-phenyl-1H-inden-1-yl]silane (PubChem CID 101111754) has the molecular formula C34H32Si and a molecular weight of 468.72 g/mol. Its IUPAC name is dimethyl-bis[(1R)-2-methyl-4-phenyl-1H-inden-1-yl]silane.
| Compound Name | dimethyl-bis[(1R)-2-methyl-4-phenyl-1H-inden-1-yl]silane |
|---|---|
| PubChem CID | 101111754 |
| Molecular Formula | C34H32Si |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | dimethyl-bis[(1R)-2-methyl-4-phenyl-1H-inden-1-yl]silane |
| SMILES | CC1=Cc2c(-c3ccccc3)cccc2[C@@H]1[Si](C)(C)[C@@H]1C(C)=Cc2c(-c3ccccc3)cccc21 |
| InChI | InChI=1S/C34H32Si/c1-23-21-31-27(25-13-7-5-8-14-25)17-11-19-29(31)33(23)35(3,4)34-24(2)22-32-28(18-12-20-30(32)34)26-15-9-6-10-16-26/h5-22,33-34H,1-4H3/t33-,34-/m1/s1 |
| InChIKey | OZIJRVRERJTEGQ-KKLWWLSJSA-N |
| XLogP | 9.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|