C36H34Si — CID 139774717
(2-methyl-4-phenyl-1H-inden-1-yl)-diphenyl-(2,3,5-trimethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 139774717) has the molecular formula C36H34Si and a molecular weight of 494.75 g/mol. Its IUPAC name is (2-methyl-4-phenyl-1H-inden-1-yl)-diphenyl-(2,3,5-trimethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | (2-methyl-4-phenyl-1H-inden-1-yl)-diphenyl-(2,3,5-trimethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 139774717 |
| Molecular Formula | C36H34Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | (2-methyl-4-phenyl-1H-inden-1-yl)-diphenyl-(2,3,5-trimethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC(C)=C(C)C1[Si](c1ccccc1)(c1ccccc1)C1C(C)=Cc2c(-c3ccccc3)cccc21 |
| InChI | InChI=1S/C36H34Si/c1-25-23-26(2)35(28(25)4)37(30-17-10-6-11-18-30,31-19-12-7-13-20-31)36-27(3)24-34-32(21-14-22-33(34)36)29-15-8-5-9-16-29/h5-24,35-36H,1-4H3 |
| InChIKey | ISDYNFJODYOWGJ-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|