C51H56Si — CID 102398548
(2-methyl-1H-inden-1-yl)-(5,5,8,8,16,16,19,19-octamethyl-12-pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),10,13,15(20)-hexaenyl)-diphenylsilane (PubChem CID 102398548) has the molecular formula C51H56Si and a molecular weight of 697.10 g/mol. Its IUPAC name is (2-methyl-1H-inden-1-yl)-(5,5,8,8,16,16,19,19-octamethyl-12-pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),10,13,15(20)-hexaenyl)-diphenylsilane.
| Compound Name | (2-methyl-1H-inden-1-yl)-(5,5,8,8,16,16,19,19-octamethyl-12-pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),10,13,15(20)-hexaenyl)-diphenylsilane |
|---|---|
| PubChem CID | 102398548 |
| Molecular Formula | C51H56Si |
| Molecular Weight | 697.10 g/mol |
| Exact Mass | 696.42 |
| IUPAC Name | (2-methyl-1H-inden-1-yl)-(5,5,8,8,16,16,19,19-octamethyl-12-pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),10,13,15(20)-hexaenyl)-diphenylsilane |
| SMILES | CC1=Cc2ccccc2C1[Si](c1ccccc1)(c1ccccc1)C1c2cc3c(cc2-c2cc4c(cc21)C(C)(C)CCC4(C)C)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C51H56Si/c1-33-28-34-18-16-17-23-37(34)46(33)52(35-19-12-10-13-20-35,36-21-14-11-15-22-36)47-40-31-44-42(48(2,3)24-26-50(44,6)7)29-38(40)39-30-43-45(32-41(39)47)51(8,9)27-25-49(43,4)5/h10-23,28-32,46-47H,24-27H2,1-9H3 |
| InChIKey | WILOGCBFEIGIQX-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.10 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|