C45H39N3 — CID 171749065
2-phenyl-4-(4-phenylphenyl)-6-[5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)naphthalen-1-yl]-1,3,5-triazine (PubChem CID 171749065) has the molecular formula C45H39N3 and a molecular weight of 621.83 g/mol. Its IUPAC name is 2-phenyl-4-(4-phenylphenyl)-6-[5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)naphthalen-1-yl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(4-phenylphenyl)-6-[5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)naphthalen-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 171749065 |
| Molecular Formula | C45H39N3 |
| Molecular Weight | 621.83 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | 2-phenyl-4-(4-phenylphenyl)-6-[5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)naphthalen-1-yl]-1,3,5-triazine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cccc4c(-c5nc(-c6ccccc6)nc(-c6ccc(-c7ccccc7)cc6)n5)cccc34)ccc21 |
| InChI | InChI=1S/C45H39N3/c1-44(2)27-28-45(3,4)40-29-34(25-26-39(40)44)35-17-11-19-37-36(35)18-12-20-38(37)43-47-41(32-15-9-6-10-16-32)46-42(48-43)33-23-21-31(22-24-33)30-13-7-5-8-14-30/h5-26,29H,27-28H2,1-4H3 |
| InChIKey | FLJJUHZPJQIZMP-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.83 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |