C49H41N3 — CID 171748924
2,4-diphenyl-6-[10-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]anthracen-9-yl]-1,3,5-triazine (PubChem CID 171748924) has the molecular formula C49H41N3 and a molecular weight of 671.89 g/mol. Its IUPAC name is 2,4-diphenyl-6-[10-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]anthracen-9-yl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[10-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]anthracen-9-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 171748924 |
| Molecular Formula | C49H41N3 |
| Molecular Weight | 671.89 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | 2,4-diphenyl-6-[10-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]anthracen-9-yl]-1,3,5-triazine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3ccc(-c4c5ccccc5c(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c5ccccc45)cc3)ccc21 |
| InChI | InChI=1S/C49H41N3/c1-48(2)29-30-49(3,4)42-31-36(27-28-41(42)48)32-23-25-33(26-24-32)43-37-19-11-13-21-39(37)44(40-22-14-12-20-38(40)43)47-51-45(34-15-7-5-8-16-34)50-46(52-47)35-17-9-6-10-18-35/h5-28,31H,29-30H2,1-4H3 |
| InChIKey | RALZNADQPDCWMM-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.89 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|