C44H48N4 — CID 171749174
2-(3,5-ditert-butylphenyl)-4-[3-isocyano-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 171749174) has the molecular formula C44H48N4 and a molecular weight of 632.90 g/mol. Its IUPAC name is 2-(3,5-ditert-butylphenyl)-4-[3-isocyano-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(3,5-ditert-butylphenyl)-4-[3-isocyano-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 171749174 |
| Molecular Formula | C44H48N4 |
| Molecular Weight | 632.90 g/mol |
| Exact Mass | 632.39 |
| IUPAC Name | 2-(3,5-ditert-butylphenyl)-4-[3-isocyano-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1cc(-c2ccc3c(c2)C(C)(C)CCC3(C)C)cc(-c2nc(-c3ccccc3)nc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)n2)c1 |
| InChI | InChI=1S/C44H48N4/c1-41(2,3)33-22-32(23-34(27-33)42(4,5)6)40-47-38(28-15-13-12-14-16-28)46-39(48-40)31-21-30(24-35(25-31)45-11)29-17-18-36-37(26-29)44(9,10)20-19-43(36,7)8/h12-18,21-27H,19-20H2,1-10H3 |
| InChIKey | VQNDJLWEMJPVKC-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 43.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.90 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|