C41H42FN3 — CID 171749143
2-(4-cyclohexylphenyl)-4-[3-fluoro-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 171749143) has the molecular formula C41H42FN3 and a molecular weight of 595.81 g/mol. Its IUPAC name is 2-(4-cyclohexylphenyl)-4-[3-fluoro-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(4-cyclohexylphenyl)-4-[3-fluoro-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 171749143 |
| Molecular Formula | C41H42FN3 |
| Molecular Weight | 595.81 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | 2-(4-cyclohexylphenyl)-4-[3-fluoro-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cc(F)cc(-c4nc(-c5ccccc5)nc(-c5ccc(C6CCCCC6)cc5)n4)c3)ccc21 |
| InChI | InChI=1S/C41H42FN3/c1-40(2)21-22-41(3,4)36-26-31(19-20-35(36)40)32-23-33(25-34(42)24-32)39-44-37(29-13-9-6-10-14-29)43-38(45-39)30-17-15-28(16-18-30)27-11-7-5-8-12-27/h6,9-10,13-20,23-27H,5,7-8,11-12,21-22H2,1-4H3 |
| InChIKey | BGBVXKBJHUAYNO-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.81 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |