About 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine
4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine (PubChem CID 140825834) has the molecular formula C31H31N
and a molecular weight of 417.60 g/mol. Its IUPAC name is 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine.
Molecular Properties
| Compound Name | 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine |
| PubChem CID | 140825834 |
| Molecular Formula | C31H31N |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine |
| SMILES | CC1(C)CCC(c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)c3)cc2)CC1 |
| InChI | InChI=1S/C31H31N/c1-31(2)19-17-25(18-20-31)23-13-15-24(16-14-23)28-21-29(26-9-5-3-6-10-26)32-30(22-28)27-11-7-4-8-12-27/h3-16,21-22,25H,17-20H2,1-2H3 |
| InChIKey | RNSHEXONCFGXPU-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine?
The IUPAC name of 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine (CID 140825834) is 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine.
What is the SMILES notation for 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine?
The canonical SMILES for 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine is CC1(C)CCC(c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)c3)cc2)CC1.
What is the InChIKey of 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine?
The InChIKey is RNSHEXONCFGXPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H31N/c1-31(2)19-17-25(18-20-31)23-13-15-24(16-14-23)28-21-29(26-9-5-3-6-10-26)32-30(22-28)27-11-7-4-8-12-27/h3-16,21-22,25H,17-20H2,1-2H3.
What are the key properties of 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine?
4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine has a molecular weight of 417.60 g/mol, XLogP of 8.77, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4,4-dimethylcyclohexyl)phenyl]-2,6-diphenylpyridine is sourced from PubChem (CID 140825834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).