C15H15N — CID 138981639
4-cyclopropyl-2-methyl-6-phenylpyridine (PubChem CID 138981639) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-cyclopropyl-2-methyl-6-phenylpyridine.
| Compound Name | 4-cyclopropyl-2-methyl-6-phenylpyridine |
|---|---|
| PubChem CID | 138981639 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-cyclopropyl-2-methyl-6-phenylpyridine |
| SMILES | Cc1cc(C2CC2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H15N/c1-11-9-14(12-7-8-12)10-15(16-11)13-5-3-2-4-6-13/h2-6,9-10,12H,7-8H2,1H3 |
| InChIKey | WJAPZXBGNFPFBO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |