C12H10FN — CID 131074497
4-fluoro-2-methyl-6-phenylpyridine (PubChem CID 131074497) has the molecular formula C12H10FN and a molecular weight of 187.22 g/mol. Its IUPAC name is 4-fluoro-2-methyl-6-phenylpyridine.
| Compound Name | 4-fluoro-2-methyl-6-phenylpyridine |
|---|---|
| PubChem CID | 131074497 |
| Molecular Formula | C12H10FN |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 4-fluoro-2-methyl-6-phenylpyridine |
| SMILES | Cc1cc(F)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H10FN/c1-9-7-11(13)8-12(14-9)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | KTGFRPRDECJFPA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |