C58H53N3 — CID 171749098
2-[3-tert-butyl-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-4-phenyl-6-[3-(9-phenylfluoren-9-yl)phenyl]-1,3,5-triazine (PubChem CID 171749098) has the molecular formula C58H53N3 and a molecular weight of 792.08 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-4-phenyl-6-[3-(9-phenylfluoren-9-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[3-tert-butyl-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-4-phenyl-6-[3-(9-phenylfluoren-9-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 171749098 |
| Molecular Formula | C58H53N3 |
| Molecular Weight | 792.08 g/mol |
| Exact Mass | 791.42 |
| IUPAC Name | 2-[3-tert-butyl-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]-4-phenyl-6-[3-(9-phenylfluoren-9-yl)phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1cc(-c2ccc3c(c2)C(C)(C)CCC3(C)C)cc(-c2nc(-c3ccccc3)nc(-c3cccc(C4(c5ccccc5)c5ccccc5-c5ccccc54)c3)n2)c1 |
| InChI | InChI=1S/C58H53N3/c1-55(2,3)45-35-41(39-29-30-50-51(37-39)57(6,7)32-31-56(50,4)5)33-42(36-45)54-60-52(38-19-10-8-11-20-38)59-53(61-54)40-21-18-24-44(34-40)58(43-22-12-9-13-23-43)48-27-16-14-25-46(48)47-26-15-17-28-49(47)58/h8-30,33-37H,31-32H2,1-7H3 |
| InChIKey | WXEWMXUQDVWFGI-UHFFFAOYSA-N |
| XLogP | 14.55 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.08 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |