C69H58 — CID 140873472
9,9-bis[3-[3-tert-butyl-5-(3-phenylphenyl)phenyl]phenyl]fluorene (PubChem CID 140873472) has the molecular formula C69H58 and a molecular weight of 887.22 g/mol. Its IUPAC name is 9,9-bis[3-[3-tert-butyl-5-(3-phenylphenyl)phenyl]phenyl]fluorene.
| Compound Name | 9,9-bis[3-[3-tert-butyl-5-(3-phenylphenyl)phenyl]phenyl]fluorene |
|---|---|
| PubChem CID | 140873472 |
| Molecular Formula | C69H58 |
| Molecular Weight | 887.22 g/mol |
| Exact Mass | 886.45 |
| IUPAC Name | 9,9-bis[3-[3-tert-butyl-5-(3-phenylphenyl)phenyl]phenyl]fluorene |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3ccccc3)c2)cc(-c2cccc(C3(c4cccc(-c5cc(-c6cccc(-c7ccccc7)c6)cc(C(C)(C)C)c5)c4)c4ccccc4-c4ccccc43)c2)c1 |
| InChI | InChI=1S/C69H58/c1-67(2,3)61-43-55(51-27-17-25-49(37-51)47-21-9-7-10-22-47)39-57(45-61)53-29-19-31-59(41-53)69(65-35-15-13-33-63(65)64-34-14-16-36-66(64)69)60-32-20-30-54(42-60)58-40-56(44-62(46-58)68(4,5)6)52-28-18-26-50(38-52)48-23-11-8-12-24-48/h7-46H,1-6H3 |
| InChIKey | ADNGMCWTQSGFBT-UHFFFAOYSA-N |
| XLogP | 18.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.22 |
| LogP ≤ 5 | 18.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |