C90H84 — CID 164755546
9,9-bis[3-[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-3-methyl-5-(2-phenylphenyl)fluorene (PubChem CID 164755546) has the molecular formula C90H84 and a molecular weight of 1165.66 g/mol. Its IUPAC name is 9,9-bis[3-[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-3-methyl-5-(2-phenylphenyl)fluorene.
| Compound Name | 9,9-bis[3-[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-3-methyl-5-(2-phenylphenyl)fluorene |
|---|---|
| PubChem CID | 164755546 |
| Molecular Formula | C90H84 |
| Molecular Weight | 1165.66 g/mol |
| Exact Mass | 1164.66 |
| IUPAC Name | 9,9-bis[3-[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-3-methyl-5-(2-phenylphenyl)fluorene |
| SMILES | Cc1ccc2c(c1)-c1c(-c3ccccc3-c3ccccc3)cccc1C2(c1cccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3ccc(C(C)(C)C)cc3)c2)c1)c1cccc(-c2cc(-c3ccc(C(C)(C)C)cc3)cc(-c3ccc(C(C)(C)C)cc3)c2)c1 |
| InChI | InChI=1S/C90H84/c1-59-32-49-83-82(50-59)85-81(80-29-18-17-28-79(80)64-22-15-14-16-23-64)30-21-31-84(85)90(83,77-26-19-24-65(57-77)71-53-67(60-33-41-73(42-34-60)86(2,3)4)51-68(54-71)61-35-43-74(44-36-61)87(5,6)7)78-27-20-25-66(58-78)72-55-69(62-37-45-75(46-38-62)88(8,9)10)52-70(56-72)63-39-47-76(48-40-63)89(11,12)13/h14-58H,1-13H3 |
| InChIKey | OORZNJZMDIZTGE-UHFFFAOYSA-N |
| XLogP | 24.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1165.66 |
| LogP ≤ 5 | 24.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |