C32H20Br4 — CID 164755474
9,9-bis(3,5-dibromophenyl)-3-methyl-5-phenylfluorene (PubChem CID 164755474) has the molecular formula C32H20Br4 and a molecular weight of 724.13 g/mol. Its IUPAC name is 9,9-bis(3,5-dibromophenyl)-3-methyl-5-phenylfluorene.
| Compound Name | 9,9-bis(3,5-dibromophenyl)-3-methyl-5-phenylfluorene |
|---|---|
| PubChem CID | 164755474 |
| Molecular Formula | C32H20Br4 |
| Molecular Weight | 724.13 g/mol |
| Exact Mass | 719.83 |
| IUPAC Name | 9,9-bis(3,5-dibromophenyl)-3-methyl-5-phenylfluorene |
| SMILES | Cc1ccc2c(c1)-c1c(-c3ccccc3)cccc1C2(c1cc(Br)cc(Br)c1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C32H20Br4/c1-19-10-11-29-28(12-19)31-27(20-6-3-2-4-7-20)8-5-9-30(31)32(29,21-13-23(33)17-24(34)14-21)22-15-25(35)18-26(36)16-22/h2-18H,1H3 |
| InChIKey | XRFZABRRFWURKG-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.13 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |