C37H22Br4 — CID 164755471
9,9-bis(3,5-dibromophenyl)-2,5-diphenylfluorene (PubChem CID 164755471) has the molecular formula C37H22Br4 and a molecular weight of 786.20 g/mol. Its IUPAC name is 9,9-bis(3,5-dibromophenyl)-2,5-diphenylfluorene.
| Compound Name | 9,9-bis(3,5-dibromophenyl)-2,5-diphenylfluorene |
|---|---|
| PubChem CID | 164755471 |
| Molecular Formula | C37H22Br4 |
| Molecular Weight | 786.20 g/mol |
| Exact Mass | 781.85 |
| IUPAC Name | 9,9-bis(3,5-dibromophenyl)-2,5-diphenylfluorene |
| SMILES | Brc1cc(Br)cc(C2(c3cc(Br)cc(Br)c3)c3cc(-c4ccccc4)ccc3-c3c(-c4ccccc4)cccc32)c1 |
| InChI | InChI=1S/C37H22Br4/c38-28-17-26(18-29(39)21-28)37(27-19-30(40)22-31(41)20-27)34-13-7-12-32(24-10-5-2-6-11-24)36(34)33-15-14-25(16-35(33)37)23-8-3-1-4-9-23/h1-22H |
| InChIKey | LFVAIFNRRNGPMA-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.20 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |