C32H18Br4O2 — CID 164755597
9,9-bis(3,5-dibromophenyl)-5-phenylindeno[1,2-f][1,3]benzodioxole (PubChem CID 164755597) has the molecular formula C32H18Br4O2 and a molecular weight of 754.11 g/mol. Its IUPAC name is 9,9-bis(3,5-dibromophenyl)-5-phenylindeno[1,2-f][1,3]benzodioxole.
| Compound Name | 9,9-bis(3,5-dibromophenyl)-5-phenylindeno[1,2-f][1,3]benzodioxole |
|---|---|
| PubChem CID | 164755597 |
| Molecular Formula | C32H18Br4O2 |
| Molecular Weight | 754.11 g/mol |
| Exact Mass | 749.80 |
| IUPAC Name | 9,9-bis(3,5-dibromophenyl)-5-phenylindeno[1,2-f][1,3]benzodioxole |
| SMILES | Brc1cc(Br)cc(C2(c3cc(Br)cc(Br)c3)c3cc4c(cc3-c3c(-c5ccccc5)cccc32)OCO4)c1 |
| InChI | InChI=1S/C32H18Br4O2/c33-21-9-19(10-22(34)13-21)32(20-11-23(35)14-24(36)12-20)27-8-4-7-25(18-5-2-1-3-6-18)31(27)26-15-29-30(16-28(26)32)38-17-37-29/h1-16H,17H2 |
| InChIKey | PNLQNROBQIKKGO-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.11 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |