C38H24Br2O2 — CID 155009263
9,9-bis(3-bromophenyl)-5-(3-phenylphenyl)indeno[1,2-f][1,3]benzodioxole (PubChem CID 155009263) has the molecular formula C38H24Br2O2 and a molecular weight of 672.42 g/mol. Its IUPAC name is 9,9-bis(3-bromophenyl)-5-(3-phenylphenyl)indeno[1,2-f][1,3]benzodioxole.
| Compound Name | 9,9-bis(3-bromophenyl)-5-(3-phenylphenyl)indeno[1,2-f][1,3]benzodioxole |
|---|---|
| PubChem CID | 155009263 |
| Molecular Formula | C38H24Br2O2 |
| Molecular Weight | 672.42 g/mol |
| Exact Mass | 670.01 |
| IUPAC Name | 9,9-bis(3-bromophenyl)-5-(3-phenylphenyl)indeno[1,2-f][1,3]benzodioxole |
| SMILES | Brc1cccc(C2(c3cccc(Br)c3)c3cc4c(cc3-c3c(-c5cccc(-c6ccccc6)c5)cccc32)OCO4)c1 |
| InChI | InChI=1S/C38H24Br2O2/c39-29-14-5-12-27(19-29)38(28-13-6-15-30(40)20-28)33-17-7-16-31(26-11-4-10-25(18-26)24-8-2-1-3-9-24)37(33)32-21-35-36(22-34(32)38)42-23-41-35/h1-22H,23H2 |
| InChIKey | UYZVECIUASILRI-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.42 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |